ChemNet > CAS > 465514-67-4 4-[2-(3-metoksyfenyl)acetyl]benzonitril
465514-67-4 4-[2-(3-metoksyfenyl)acetyl]benzonitril
| produktnavn |
4-[2-(3-metoksyfenyl)acetyl]benzonitril |
| Synonymer |
4-[(3-metoksyfenyl)acetyl]benzonitril |
| Engelsk navn |
4-[2-(3-methoxyphenyl)acetyl]benzonitrile;4-[(3-methoxyphenyl)acetyl]benzonitrile |
| Molekylær Formel |
C16H13NO2 |
| Molekylvekt |
251.2799 |
| InChI |
InChI=1/C16H13NO2/c1-19-15-4-2-3-13(9-15)10-16(18)14-7-5-12(11-17)6-8-14/h2-9H,10H2,1H3 |
| CAS-nummer |
465514-67-4 |
| Molecular Structure |
|
| Tetthet |
1.18g/cm3 |
| Smeltepunkt |
113.9℃ |
| Kokepunkt |
445.6°C at 760 mmHg |
| Brytningsindeks |
1.592 |
| Flammepunktet |
194.4°C |
| Damptrykk |
3.9E-08mmHg at 25°C |
| Hazard symboler |
Xn:Harmful;
|
| Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|